C14H21N2ORe- — CID 59304401
2-(cyclohexylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium (PubChem CID 59304401) has the molecular formula C14H21N2ORe- and a molecular weight of 419.54 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium.
| Compound Name | 2-(cyclohexylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium |
|---|---|
| PubChem CID | 59304401 |
| Molecular Formula | C14H21N2ORe- |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2-(cyclohexylmethyl)-5-propan-2-ylpyrimidin-3-id-4-one;rhenium |
| SMILES | CC(C)c1cnc(CC2CCCCC2)[n-]c1=O.[Re] |
| InChI | InChI=1S/C14H22N2O.Re/c1-10(2)12-9-15-13(16-14(12)17)8-11-6-4-3-5-7-11;/h9-11H,3-8H2,1-2H3,(H,15,16,17);/p-1 |
| InChIKey | DOUYNXLIDHTCTJ-UHFFFAOYSA-M |
| XLogP | 2.64 |
| TPSA | 44.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |