C54H56N2O2 — CID 59309025
1-N,6-N-bis(4-butoxy-2,6-dimethylphenyl)-1-N,6-N-bis(4-methylphenyl)pyrene-1,6-diamine (PubChem CID 59309025) has the molecular formula C54H56N2O2 and a molecular weight of 765.05 g/mol. Its IUPAC name is 1-N,6-N-bis(4-butoxy-2,6-dimethylphenyl)-1-N,6-N-bis(4-methylphenyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(4-butoxy-2,6-dimethylphenyl)-1-N,6-N-bis(4-methylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 59309025 |
| Molecular Formula | C54H56N2O2 |
| Molecular Weight | 765.05 g/mol |
| Exact Mass | 764.43 |
| IUPAC Name | 1-N,6-N-bis(4-butoxy-2,6-dimethylphenyl)-1-N,6-N-bis(4-methylphenyl)pyrene-1,6-diamine |
| SMILES | CCCCOc1cc(C)c(N(c2ccc(C)cc2)c2ccc3ccc4c(N(c5ccc(C)cc5)c5c(C)cc(OCCCC)cc5C)ccc5ccc2c3c54)c(C)c1 |
| InChI | InChI=1S/C54H56N2O2/c1-9-11-29-57-45-31-37(5)53(38(6)32-45)55(43-21-13-35(3)14-22-43)49-27-19-41-18-26-48-50(28-20-42-17-25-47(49)51(41)52(42)48)56(44-23-15-36(4)16-24-44)54-39(7)33-46(34-40(54)8)58-30-12-10-2/h13-28,31-34H,9-12,29-30H2,1-8H3 |
| InChIKey | KFRCCXFEBVOJDN-UHFFFAOYSA-N |
| XLogP | 15.73 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.05 |
| LogP ≤ 5 | 15.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|