C18H14N6O2S2 — CID 59311441
3-[[5-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine (PubChem CID 59311441) has the molecular formula C18H14N6O2S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-[[5-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine.
| Compound Name | 3-[[5-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 59311441 |
| Molecular Formula | C18H14N6O2S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 3-[[5-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]methyl]-9-thia-2,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine |
| SMILES | Nc1nc2c3c(nn(Cc4ncc(-c5ccc6c(c5)OCO6)s4)c3n1)CCS2 |
| InChI | InChI=1S/C18H14N6O2S2/c19-18-21-16-15-10(3-4-27-17(15)22-18)23-24(16)7-14-20-6-13(28-14)9-1-2-11-12(5-9)26-8-25-11/h1-2,5-6H,3-4,7-8H2,(H2,19,21,22) |
| InChIKey | OUXWYHNRHDEHHV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |