About lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol
lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol (PubChem CID 59312011) has the molecular formula C9H16LaNO-
and a molecular weight of 293.14 g/mol. Its IUPAC name is lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol.
Molecular Properties
| Compound Name | lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol |
| PubChem CID | 59312011 |
| Molecular Formula | C9H16LaNO- |
| Molecular Weight | 293.14 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol |
| SMILES | C=CCC1(CO)CC[N-]CC1.[La] |
| InChI | InChI=1S/C9H16NO.La/c1-2-3-9(8-11)4-6-10-7-5-9;/h2,11H,1,3-8H2;/q-1; |
| InChIKey | VQAMAQFHAANJGU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 34.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.14 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol?
The IUPAC name of lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol (CID 59312011) is lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol.
What is the SMILES notation for lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol?
The canonical SMILES for lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol is C=CCC1(CO)CC[N-]CC1.[La].
What is the InChIKey of lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol?
The InChIKey is VQAMAQFHAANJGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16NO.La/c1-2-3-9(8-11)4-6-10-7-5-9;/h2,11H,1,3-8H2;/q-1;.
What are the key properties of lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol?
lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol has a molecular weight of 293.14 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lanthanum;(4-prop-2-enylpiperidin-1-id-4-yl)methanol is sourced from PubChem (CID 59312011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).