About lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide
lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide (PubChem CID 59312076) has the molecular formula C10H18LaNO-
and a molecular weight of 307.17 g/mol. Its IUPAC name is lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide.
Molecular Properties
| Compound Name | lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide |
| PubChem CID | 59312076 |
| Molecular Formula | C10H18LaNO- |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide |
| SMILES | C=CCC1(COC)CC[N-]CC1.[La] |
| InChI | InChI=1S/C10H18NO.La/c1-3-4-10(9-12-2)5-7-11-8-6-10;/h3H,1,4-9H2,2H3;/q-1; |
| InChIKey | OVYNXOPTAGTEIA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide?
The IUPAC name of lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide (CID 59312076) is lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide.
What is the SMILES notation for lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide?
The canonical SMILES for lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide is C=CCC1(COC)CC[N-]CC1.[La].
What is the InChIKey of lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide?
The InChIKey is OVYNXOPTAGTEIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18NO.La/c1-3-4-10(9-12-2)5-7-11-8-6-10;/h3H,1,4-9H2,2H3;/q-1;.
What are the key properties of lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide?
lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide has a molecular weight of 307.17 g/mol, XLogP of 2.36, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lanthanum;4-(methoxymethyl)-4-prop-2-enylpiperidin-1-ide is sourced from PubChem (CID 59312076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).