C14H31NO — CID 142009450
methoxyethane;prop-1-ene;1,4,4-trimethylpiperidine (PubChem CID 142009450) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is methoxyethane;prop-1-ene;1,4,4-trimethylpiperidine.
| Compound Name | methoxyethane;prop-1-ene;1,4,4-trimethylpiperidine |
|---|---|
| PubChem CID | 142009450 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | methoxyethane;prop-1-ene;1,4,4-trimethylpiperidine |
| SMILES | C=CC.CCOC.CN1CCC(C)(C)CC1 |
| InChI | InChI=1S/C8H17N.C3H8O.C3H6/c1-8(2)4-6-9(3)7-5-8;1-3-4-2;1-3-2/h4-7H2,1-3H3;3H2,1-2H3;3H,1H2,2H3 |
| InChIKey | OZTGDLKZNZUKOQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|