C13H27NO — CID 142009708
1-(2-methoxyethyl)-4,4-dimethylpiperidine;prop-1-ene (PubChem CID 142009708) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4,4-dimethylpiperidine;prop-1-ene.
| Compound Name | 1-(2-methoxyethyl)-4,4-dimethylpiperidine;prop-1-ene |
|---|---|
| PubChem CID | 142009708 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 1-(2-methoxyethyl)-4,4-dimethylpiperidine;prop-1-ene |
| SMILES | C=CC.COCCN1CCC(C)(C)CC1 |
| InChI | InChI=1S/C10H21NO.C3H6/c1-10(2)4-6-11(7-5-10)8-9-12-3;1-3-2/h4-9H2,1-3H3;3H,1H2,2H3 |
| InChIKey | VTUDBCVHRWOIGD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|