C30H27F4N3O2 — CID 59314916
3-benzhydryl-2-methyl-6-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 59314916) has the molecular formula C30H27F4N3O2 and a molecular weight of 537.56 g/mol. Its IUPAC name is 3-benzhydryl-2-methyl-6-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 3-benzhydryl-2-methyl-6-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 59314916 |
| Molecular Formula | C30H27F4N3O2 |
| Molecular Weight | 537.56 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 3-benzhydryl-2-methyl-6-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)n1C(c1ccccc1)c1ccccc1)CN(Cc1cccc(OC(F)(F)C(F)F)c1)CC2 |
| InChI | InChI=1S/C30H27F4N3O2/c1-20-35-26-15-16-36(18-21-9-8-14-24(17-21)39-30(33,34)29(31)32)19-25(26)28(38)37(20)27(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-14,17,27,29H,15-16,18-19H2,1H3 |
| InChIKey | JABKJNGCRPUMQE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|