C31H37NO6 — CID 59316182
methyl 7-[(3-methoxyphenyl)methoxy]-8-[N-[(3-methoxyphenyl)methyl]anilino]-8-oxooctanoate (PubChem CID 59316182) has the molecular formula C31H37NO6 and a molecular weight of 519.64 g/mol. Its IUPAC name is methyl 7-[(3-methoxyphenyl)methoxy]-8-[N-[(3-methoxyphenyl)methyl]anilino]-8-oxooctanoate.
| Compound Name | methyl 7-[(3-methoxyphenyl)methoxy]-8-[N-[(3-methoxyphenyl)methyl]anilino]-8-oxooctanoate |
|---|---|
| PubChem CID | 59316182 |
| Molecular Formula | C31H37NO6 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | methyl 7-[(3-methoxyphenyl)methoxy]-8-[N-[(3-methoxyphenyl)methyl]anilino]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCC(OCc1cccc(OC)c1)C(=O)N(Cc1cccc(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C31H37NO6/c1-35-27-16-10-12-24(20-27)22-32(26-14-6-4-7-15-26)31(34)29(18-8-5-9-19-30(33)37-3)38-23-25-13-11-17-28(21-25)36-2/h4,6-7,10-17,20-21,29H,5,8-9,18-19,22-23H2,1-3H3 |
| InChIKey | RAROXYFTFMCERH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|