C32H44N2O9S — CID 59317320
[(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-[3-(oxan-2-yloxy)phenyl]sulfonylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 59317320) has the molecular formula C32H44N2O9S and a molecular weight of 632.78 g/mol. Its IUPAC name is [(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-[3-(oxan-2-yloxy)phenyl]sulfonylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-[3-(oxan-2-yloxy)phenyl]sulfonylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59317320 |
| Molecular Formula | C32H44N2O9S |
| Molecular Weight | 632.78 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | [(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-[3-(oxan-2-yloxy)phenyl]sulfonylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1CO[C@H]2OCCC12)S(=O)(=O)c1cccc(OC2CCCCO2)c1 |
| InChI | InChI=1S/C32H44N2O9S/c1-22(2)19-34(44(37,38)25-12-8-11-24(18-25)42-30-13-6-7-15-39-30)20-28(35)27(17-23-9-4-3-5-10-23)33-32(36)43-29-21-41-31-26(29)14-16-40-31/h3-5,8-12,18,22,26-31,35H,6-7,13-17,19-21H2,1-2H3,(H,33,36)/t26?,27-,28+,29?,30?,31+/m0/s1 |
| InChIKey | SJUWDMIZIYQRGK-RKQTUDECSA-N |
| XLogP | 3.70 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |