C22H12F2N6 — CID 59320399
6-[difluoro-[6-(3-isocyanophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]quinoline (PubChem CID 59320399) has the molecular formula C22H12F2N6 and a molecular weight of 398.38 g/mol. Its IUPAC name is 6-[difluoro-[6-(3-isocyanophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]quinoline.
| Compound Name | 6-[difluoro-[6-(3-isocyanophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]quinoline |
|---|---|
| PubChem CID | 59320399 |
| Molecular Formula | C22H12F2N6 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 6-[difluoro-[6-(3-isocyanophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]quinoline |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3nnc(C(F)(F)c4ccc5ncccc5c4)n3n2)c1 |
| InChI | InChI=1S/C22H12F2N6/c1-25-17-6-2-4-15(13-17)19-9-10-20-27-28-21(30(20)29-19)22(23,24)16-7-8-18-14(12-16)5-3-11-26-18/h2-13H |
| InChIKey | FILHOYWAEFONAM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 60.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|