C19H12BF2N7 — CID 145093146
CID 145093146 (PubChem CID 145093146) has the molecular formula C19H12BF2N7 and a molecular weight of 387.16 g/mol.
| Compound Name | CID 145093146 |
|---|---|
| PubChem CID | 145093146 |
| Molecular Formula | C19H12BF2N7 |
| Molecular Weight | 387.16 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2cc(C(F)(F)c3nnc4ccc(-c5cnn(C)c5)nn34)ccc2n1 |
| InChI | InChI=1S/C19H12BF2N7/c1-28-10-12(9-23-28)15-5-7-17-25-26-18(29(17)27-15)19(21,22)13-3-4-14-11(8-13)2-6-16(20)24-14/h2-10H,1H3 |
| InChIKey | LZDIHECEUIXJBX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|