C17H25FN2O2 — CID 59321362
tert-butyl 4-(aminomethyl)-4-(2-fluorophenyl)piperidine-1-carboxylate (PubChem CID 59321362) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is tert-butyl 4-(aminomethyl)-4-(2-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(aminomethyl)-4-(2-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59321362 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | tert-butyl 4-(aminomethyl)-4-(2-fluorophenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN)(c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H25FN2O2/c1-16(2,3)22-15(21)20-10-8-17(12-19,9-11-20)13-6-4-5-7-14(13)18/h4-7H,8-12,19H2,1-3H3 |
| InChIKey | LMODAZOWQOTKJZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |