C11H14N2O — CID 59323805
4-(1-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 59323805) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-(1-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | 4-(1-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 59323805 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 4-(1-phenylethyl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CC(c1ccccc1)C1COC(N)=N1 |
| InChI | InChI=1S/C11H14N2O/c1-8(9-5-3-2-4-6-9)10-7-14-11(12)13-10/h2-6,8,10H,7H2,1H3,(H2,12,13) |
| InChIKey | LDIIKMZTASOTJB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |