C28H26N2OS — CID 59325062
[(2R)-2-benzylpiperazin-1-yl]-(3,4-diphenylthiophen-2-yl)methanone (PubChem CID 59325062) has the molecular formula C28H26N2OS and a molecular weight of 438.60 g/mol. Its IUPAC name is [(2R)-2-benzylpiperazin-1-yl]-(3,4-diphenylthiophen-2-yl)methanone.
| Compound Name | [(2R)-2-benzylpiperazin-1-yl]-(3,4-diphenylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 59325062 |
| Molecular Formula | C28H26N2OS |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [(2R)-2-benzylpiperazin-1-yl]-(3,4-diphenylthiophen-2-yl)methanone |
| SMILES | O=C(c1scc(-c2ccccc2)c1-c1ccccc1)N1CCNC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C28H26N2OS/c31-28(30-17-16-29-19-24(30)18-21-10-4-1-5-11-21)27-26(23-14-8-3-9-15-23)25(20-32-27)22-12-6-2-7-13-22/h1-15,20,24,29H,16-19H2/t24-/m1/s1 |
| InChIKey | NEOHAWMWMOXRBR-XMMPIXPASA-N |
| XLogP | 5.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |