C27H30N4O2 — CID 69174482
2-[4-[(2R)-2-benzylpiperazine-1-carbonyl]-5-phenylimidazol-1-yl]cyclohexan-1-one (PubChem CID 69174482) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[4-[(2R)-2-benzylpiperazine-1-carbonyl]-5-phenylimidazol-1-yl]cyclohexan-1-one.
| Compound Name | 2-[4-[(2R)-2-benzylpiperazine-1-carbonyl]-5-phenylimidazol-1-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 69174482 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 2-[4-[(2R)-2-benzylpiperazine-1-carbonyl]-5-phenylimidazol-1-yl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1n1cnc(C(=O)N2CCNC[C@H]2Cc2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H30N4O2/c32-24-14-8-7-13-23(24)31-19-29-25(26(31)21-11-5-2-6-12-21)27(33)30-16-15-28-18-22(30)17-20-9-3-1-4-10-20/h1-6,9-12,19,22-23,28H,7-8,13-18H2/t22-,23?/m1/s1 |
| InChIKey | BAPBRERKTMRQTC-WTQRLHSKSA-N |
| XLogP | 3.89 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |