C32H42N4O3 — CID 68987017
[(2R)-2-benzylpiperazin-1-yl]-[1-[(1S,2S)-2-(3-methoxypropoxy)cycloheptyl]-5-phenylimidazol-4-yl]methanone (PubChem CID 68987017) has the molecular formula C32H42N4O3 and a molecular weight of 530.71 g/mol. Its IUPAC name is [(2R)-2-benzylpiperazin-1-yl]-[1-[(1S,2S)-2-(3-methoxypropoxy)cycloheptyl]-5-phenylimidazol-4-yl]methanone.
| Compound Name | [(2R)-2-benzylpiperazin-1-yl]-[1-[(1S,2S)-2-(3-methoxypropoxy)cycloheptyl]-5-phenylimidazol-4-yl]methanone |
|---|---|
| PubChem CID | 68987017 |
| Molecular Formula | C32H42N4O3 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | [(2R)-2-benzylpiperazin-1-yl]-[1-[(1S,2S)-2-(3-methoxypropoxy)cycloheptyl]-5-phenylimidazol-4-yl]methanone |
| SMILES | COCCCO[C@H]1CCCCC[C@@H]1n1cnc(C(=O)N2CCNC[C@H]2Cc2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C32H42N4O3/c1-38-20-11-21-39-29-17-10-4-9-16-28(29)36-24-34-30(31(36)26-14-7-3-8-15-26)32(37)35-19-18-33-23-27(35)22-25-12-5-2-6-13-25/h2-3,5-8,12-15,24,27-29,33H,4,9-11,16-23H2,1H3/t27-,28+,29+/m1/s1 |
| InChIKey | GLQNESQCRZJYBA-ULNSLHSMSA-N |
| XLogP | 5.13 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|