C26H25N7O2 — CID 59325576
(2S,4S)-4-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenoxy]-N-methylpyrrolidine-2-carboxamide (PubChem CID 59325576) has the molecular formula C26H25N7O2 and a molecular weight of 467.53 g/mol. Its IUPAC name is (2S,4S)-4-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenoxy]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenoxy]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59325576 |
| Molecular Formula | C26H25N7O2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | (2S,4S)-4-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenoxy]-N-methylpyrrolidine-2-carboxamide |
| SMILES | C#Cc1ccc2nc(Nc3cc(O[C@@H]4CN[C@H](C(=O)NC)C4)cc(-c4cnn(C)c4)c3)ncc2c1 |
| InChI | InChI=1S/C26H25N7O2/c1-4-16-5-6-23-18(7-16)12-29-26(32-23)31-20-8-17(19-13-30-33(3)15-19)9-21(10-20)35-22-11-24(28-14-22)25(34)27-2/h1,5-10,12-13,15,22,24,28H,11,14H2,2-3H3,(H,27,34)(H,29,31,32)/t22-,24-/m0/s1 |
| InChIKey | OZRQCJFPVYJVLQ-UPVQGACJSA-N |
| XLogP | 2.61 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|