C35H47NO7 — CID 59326334
(E,2S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-8-[3-(3-methoxypropoxy)-4-(trideuteriomethoxy)phenyl]-2,7-di(propan-2-yl)oct-4-ene-1,8-dione (PubChem CID 59326334) has the molecular formula C35H47NO7 and a molecular weight of 596.78 g/mol. Its IUPAC name is (E,2S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-8-[3-(3-methoxypropoxy)-4-(trideuteriomethoxy)phenyl]-2,7-di(propan-2-yl)oct-4-ene-1,8-dione.
| Compound Name | (E,2S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-8-[3-(3-methoxypropoxy)-4-(trideuteriomethoxy)phenyl]-2,7-di(propan-2-yl)oct-4-ene-1,8-dione |
|---|---|
| PubChem CID | 59326334 |
| Molecular Formula | C35H47NO7 |
| Molecular Weight | 596.78 g/mol |
| Exact Mass | 596.35 |
| IUPAC Name | (E,2S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-8-[3-(3-methoxypropoxy)-4-(trideuteriomethoxy)phenyl]-2,7-di(propan-2-yl)oct-4-ene-1,8-dione |
| SMILES | [2H]C([2H])([2H])Oc1ccc(C(=O)C(C/C=C/C[C@H](C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)C(C)C)C(C)C)cc1OCCCOC |
| InChI | InChI=1S/C35H47NO7/c1-24(2)29(33(37)27-17-18-31(41-6)32(22-27)42-20-12-19-40-5)15-10-11-16-30(25(3)4)34(38)36-28(23-43-35(36)39)21-26-13-8-7-9-14-26/h7-11,13-14,17-18,22,24-25,28-30H,12,15-16,19-21,23H2,1-6H3/b11-10+/t28-,29?,30-/m0/s1/i6D3 |
| InChIKey | UQHGGTZSSUGKFG-XOGKJQGCSA-N |
| XLogP | 6.76 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.78 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|