C12H28N7O+ — CID 59333027
4-[[amino-[[N'-[2-(methylamino)-2-oxoethyl]carbamimidoyl]amino]methylidene]amino]butyl-trimethylazanium (PubChem CID 59333027) has the molecular formula C12H28N7O+ and a molecular weight of 286.40 g/mol. Its IUPAC name is 4-[[amino-[[N'-[2-(methylamino)-2-oxoethyl]carbamimidoyl]amino]methylidene]amino]butyl-trimethylazanium.
| Compound Name | 4-[[amino-[[N'-[2-(methylamino)-2-oxoethyl]carbamimidoyl]amino]methylidene]amino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 59333027 |
| Molecular Formula | C12H28N7O+ |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 4-[[amino-[[N'-[2-(methylamino)-2-oxoethyl]carbamimidoyl]amino]methylidene]amino]butyl-trimethylazanium |
| SMILES | CNC(=O)C/N=C(\N)N/C(N)=N/CCCC[N+](C)(C)C |
| InChI | InChI=1S/C12H27N7O/c1-15-10(20)9-17-12(14)18-11(13)16-7-5-6-8-19(2,3)4/h5-9H2,1-4H3,(H5-,13,14,15,16,17,18,20)/p+1 |
| InChIKey | DLLZDBZDTKHPDA-UHFFFAOYSA-O |
| XLogP | -1.56 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|