C16H24F2O2Si — CID 59336031
2,3-difluoro-4-tri(propan-2-yl)silyloxybenzaldehyde (PubChem CID 59336031) has the molecular formula C16H24F2O2Si and a molecular weight of 314.45 g/mol. Its IUPAC name is 2,3-difluoro-4-tri(propan-2-yl)silyloxybenzaldehyde.
| Compound Name | 2,3-difluoro-4-tri(propan-2-yl)silyloxybenzaldehyde |
|---|---|
| PubChem CID | 59336031 |
| Molecular Formula | C16H24F2O2Si |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2,3-difluoro-4-tri(propan-2-yl)silyloxybenzaldehyde |
| SMILES | CC(C)[Si](Oc1ccc(C=O)c(F)c1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H24F2O2Si/c1-10(2)21(11(3)4,12(5)6)20-14-8-7-13(9-19)15(17)16(14)18/h7-12H,1-6H3 |
| InChIKey | DVAVOKYCCDJITO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|