C17H26F2O3Si — CID 89443690
2,6-difluoro-3-methyl-5-tri(propan-2-yl)silyloxybenzoic acid (PubChem CID 89443690) has the molecular formula C17H26F2O3Si and a molecular weight of 344.47 g/mol. Its IUPAC name is 2,6-difluoro-3-methyl-5-tri(propan-2-yl)silyloxybenzoic acid.
| Compound Name | 2,6-difluoro-3-methyl-5-tri(propan-2-yl)silyloxybenzoic acid |
|---|---|
| PubChem CID | 89443690 |
| Molecular Formula | C17H26F2O3Si |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2,6-difluoro-3-methyl-5-tri(propan-2-yl)silyloxybenzoic acid |
| SMILES | Cc1cc(O[Si](C(C)C)(C(C)C)C(C)C)c(F)c(C(=O)O)c1F |
| InChI | InChI=1S/C17H26F2O3Si/c1-9(2)23(10(3)4,11(5)6)22-13-8-12(7)15(18)14(16(13)19)17(20)21/h8-11H,1-7H3,(H,20,21) |
| InChIKey | IVVBVBHFDVWJDR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|