C12H13NO6S2 — CID 59336565
methyl [3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)phenyl] sulfate (PubChem CID 59336565) has the molecular formula C12H13NO6S2 and a molecular weight of 331.37 g/mol. Its IUPAC name is methyl [3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)phenyl] sulfate.
| Compound Name | methyl [3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)phenyl] sulfate |
|---|---|
| PubChem CID | 59336565 |
| Molecular Formula | C12H13NO6S2 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | methyl [3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)phenyl] sulfate |
| SMILES | COS(=O)(=O)Oc1cccc(N2C(=O)CC(SC)C2=O)c1 |
| InChI | InChI=1S/C12H13NO6S2/c1-18-21(16,17)19-9-5-3-4-8(6-9)13-11(14)7-10(20-2)12(13)15/h3-6,10H,7H2,1-2H3 |
| InChIKey | IFWYBKSOKGYKLT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|