C27H25FN4 — CID 59340699
1-[6-(4-fluorophenyl)-2,5-diphenylpyrimidin-4-yl]-1,4-diazepane (PubChem CID 59340699) has the molecular formula C27H25FN4 and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-[6-(4-fluorophenyl)-2,5-diphenylpyrimidin-4-yl]-1,4-diazepane.
| Compound Name | 1-[6-(4-fluorophenyl)-2,5-diphenylpyrimidin-4-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 59340699 |
| Molecular Formula | C27H25FN4 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 1-[6-(4-fluorophenyl)-2,5-diphenylpyrimidin-4-yl]-1,4-diazepane |
| SMILES | Fc1ccc(-c2nc(-c3ccccc3)nc(N3CCCNCC3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25FN4/c28-23-14-12-21(13-15-23)25-24(20-8-3-1-4-9-20)27(32-18-7-16-29-17-19-32)31-26(30-25)22-10-5-2-6-11-22/h1-6,8-15,29H,7,16-19H2 |
| InChIKey | IZNHPGJYTORZOF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |