C23H23F3N2O — CID 59342242
2-[6-[2-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]propan-2-yl]-2-pyridinyl]propan-2-ol (PubChem CID 59342242) has the molecular formula C23H23F3N2O and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-[6-[2-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]propan-2-yl]-2-pyridinyl]propan-2-ol.
| Compound Name | 2-[6-[2-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]propan-2-yl]-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 59342242 |
| Molecular Formula | C23H23F3N2O |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[6-[2-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]propan-2-yl]-2-pyridinyl]propan-2-ol |
| SMILES | CC(C)(O)c1cccc(C(C)(C)c2cccc(-c3cccc(C(F)(F)F)c3)n2)n1 |
| InChI | InChI=1S/C23H23F3N2O/c1-21(2,19-12-7-13-20(28-19)22(3,4)29)18-11-6-10-17(27-18)15-8-5-9-16(14-15)23(24,25)26/h5-14,29H,1-4H3 |
| InChIKey | LHEHGYHEONKKGG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |