C13H5F3IrNO2- — CID 59342953
iridium;7-(trifluoromethyl)-10H-isochromeno[4,3-b]pyridin-10-id-6-one (PubChem CID 59342953) has the molecular formula C13H5F3IrNO2- and a molecular weight of 456.40 g/mol. Its IUPAC name is iridium;7-(trifluoromethyl)-10H-isochromeno[4,3-b]pyridin-10-id-6-one.
| Compound Name | iridium;7-(trifluoromethyl)-10H-isochromeno[4,3-b]pyridin-10-id-6-one |
|---|---|
| PubChem CID | 59342953 |
| Molecular Formula | C13H5F3IrNO2- |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.99 |
| IUPAC Name | iridium;7-(trifluoromethyl)-10H-isochromeno[4,3-b]pyridin-10-id-6-one |
| SMILES | O=c1oc2cccnc2c2[c-]ccc(C(F)(F)F)c12.[Ir] |
| InChI | InChI=1S/C13H5F3NO2.Ir/c14-13(15,16)8-4-1-3-7-10(8)12(18)19-9-5-2-6-17-11(7)9;/h1-2,4-6H;/q-1; |
| InChIKey | HCXAIRWRCVHRIG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|