C30H37N3O4Si — CID 59343837
[(3R,4R)-5-azido-3-methoxy-4-phenylmethoxyoxan-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 59343837) has the molecular formula C30H37N3O4Si and a molecular weight of 531.73 g/mol. Its IUPAC name is [(3R,4R)-5-azido-3-methoxy-4-phenylmethoxyoxan-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3R,4R)-5-azido-3-methoxy-4-phenylmethoxyoxan-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 59343837 |
| Molecular Formula | C30H37N3O4Si |
| Molecular Weight | 531.73 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | [(3R,4R)-5-azido-3-methoxy-4-phenylmethoxyoxan-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CO[C@H]1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCC(N=[N+]=[N-])[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H37N3O4Si/c1-30(2,3)38(24-16-10-6-11-17-24,25-18-12-7-13-19-25)37-22-27-29(34-4)28(26(21-35-27)32-33-31)36-20-23-14-8-5-9-15-23/h5-19,26-29H,20-22H2,1-4H3/t26?,27?,28-,29+/m1/s1 |
| InChIKey | VGSJGUSUKKGAJV-FNUNSLKWSA-N |
| XLogP | 5.24 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.73 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|