C27H31N3O2S — CID 59344855
1-(4-methoxyphenyl)-N-[6-[4-[(methylsulfanylamino)methyl]phenyl]-2-pyridinyl]cyclohexane-1-carboxamide (PubChem CID 59344855) has the molecular formula C27H31N3O2S and a molecular weight of 461.63 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-[6-[4-[(methylsulfanylamino)methyl]phenyl]-2-pyridinyl]cyclohexane-1-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-N-[6-[4-[(methylsulfanylamino)methyl]phenyl]-2-pyridinyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 59344855 |
| Molecular Formula | C27H31N3O2S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-[6-[4-[(methylsulfanylamino)methyl]phenyl]-2-pyridinyl]cyclohexane-1-carboxamide |
| SMILES | COc1ccc(C2(C(=O)Nc3cccc(-c4ccc(CNSC)cc4)n3)CCCCC2)cc1 |
| InChI | InChI=1S/C27H31N3O2S/c1-32-23-15-13-22(14-16-23)27(17-4-3-5-18-27)26(31)30-25-8-6-7-24(29-25)21-11-9-20(10-12-21)19-28-33-2/h6-16,28H,3-5,17-19H2,1-2H3,(H,29,30,31) |
| InChIKey | GABCJHVQXLSODE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|