C9H13NO2 — CID 59348047
3-[(1R)-1-deuterio-1-hydroxy-2-(methylamino)ethyl]phenol (PubChem CID 59348047) has the molecular formula C9H13NO2 and a molecular weight of 168.21 g/mol. Its IUPAC name is 3-[(1R)-1-deuterio-1-hydroxy-2-(methylamino)ethyl]phenol.
| Compound Name | 3-[(1R)-1-deuterio-1-hydroxy-2-(methylamino)ethyl]phenol |
|---|---|
| PubChem CID | 59348047 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 3-[(1R)-1-deuterio-1-hydroxy-2-(methylamino)ethyl]phenol |
| SMILES | [2H][C@](O)(CNC)c1cccc(O)c1 |
| InChI | InChI=1S/C9H13NO2/c1-10-6-9(12)7-3-2-4-8(11)5-7/h2-5,9-12H,6H2,1H3/t9-/m0/s1/i9D |
| InChIKey | SONNWYBIRXJNDC-VNBPQMKGSA-N |
| XLogP | 0.64 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |