C11H17NO3 — CID 59348055
2,2-dideuterio-1-[3-(methoxymethoxy)phenyl]-2-(trideuteriomethylamino)ethanol (PubChem CID 59348055) has the molecular formula C11H17NO3 and a molecular weight of 216.29 g/mol. Its IUPAC name is 2,2-dideuterio-1-[3-(methoxymethoxy)phenyl]-2-(trideuteriomethylamino)ethanol.
| Compound Name | 2,2-dideuterio-1-[3-(methoxymethoxy)phenyl]-2-(trideuteriomethylamino)ethanol |
|---|---|
| PubChem CID | 59348055 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2,2-dideuterio-1-[3-(methoxymethoxy)phenyl]-2-(trideuteriomethylamino)ethanol |
| SMILES | [2H]C([2H])([2H])NC([2H])([2H])C(O)c1cccc(OCOC)c1 |
| InChI | InChI=1S/C11H17NO3/c1-12-7-11(13)9-4-3-5-10(6-9)15-8-14-2/h3-6,11-13H,7-8H2,1-2H3/i1D3,7D2 |
| InChIKey | QDPNUIOADQASBT-WRMAMSRYSA-N |
| XLogP | 0.92 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|