C12H18O5 — CID 76530110
1-[3-(2-methoxyethoxymethoxy)phenyl]ethane-1,2-diol (PubChem CID 76530110) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxymethoxy)phenyl]ethane-1,2-diol.
| Compound Name | 1-[3-(2-methoxyethoxymethoxy)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 76530110 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-[3-(2-methoxyethoxymethoxy)phenyl]ethane-1,2-diol |
| SMILES | COCCOCOc1cccc(C(O)CO)c1 |
| InChI | InChI=1S/C12H18O5/c1-15-5-6-16-9-17-11-4-2-3-10(7-11)12(14)8-13/h2-4,7,12-14H,5-6,8-9H2,1H3 |
| InChIKey | PSFYHOBMTFQKKS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|