C23H36N8O5 — CID 59350432
(2S)-2-acetamido-N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-methylpentanediamide (PubChem CID 59350432) has the molecular formula C23H36N8O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-methylpentanediamide.
| Compound Name | (2S)-2-acetamido-N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-methylpentanediamide |
|---|---|
| PubChem CID | 59350432 |
| Molecular Formula | C23H36N8O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | (2S)-2-acetamido-N-[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-N-methylpentanediamide |
| SMILES | CC(=O)N[C@@H](CCC(N)=O)C(=O)N(C)[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C23H36N8O5/c1-14(32)29-16(10-11-19(24)33)22(36)31(2)18(9-6-12-28-23(26)27)21(35)30-17(20(25)34)13-15-7-4-3-5-8-15/h3-5,7-8,16-18H,6,9-13H2,1-2H3,(H2,24,33)(H2,25,34)(H,29,32)(H,30,35)(H4,26,27,28)/t16-,17-,18-/m0/s1 |
| InChIKey | QYJYZRIRRAUUKA-BZSNNMDCSA-N |
| XLogP | -2.15 |
| TPSA | 229.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|