About 6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine
6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine (PubChem CID 59352806) has the molecular formula C7H6BrN3O
and a molecular weight of 228.05 g/mol. Its IUPAC name is 6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine.
Analyze 6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine?
The IUPAC name of 6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine (CID 59352806) is 6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine.
What is the SMILES notation for 6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine?
The canonical SMILES for 6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine is Cc1nc2oc(N)nc2cc1Br.
What is the InChIKey of 6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine?
The InChIKey is BZXXMWDAXOGMFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3O/c1-3-4(8)2-5-6(10-3)12-7(9)11-5/h2H,1H3,(H2,9,11).
What are the key properties of 6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine?
6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine has a molecular weight of 228.05 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-amine is sourced from PubChem (CID 59352806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).