C29H22ClFN6O2 — CID 59353376
ethyl (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-(4-pyridin-4-ylpyrazol-1-yl)pyrimidin-5-yl]phenyl]prop-2-enoate (PubChem CID 59353376) has the molecular formula C29H22ClFN6O2 and a molecular weight of 540.99 g/mol. Its IUPAC name is ethyl (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-(4-pyridin-4-ylpyrazol-1-yl)pyrimidin-5-yl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-(4-pyridin-4-ylpyrazol-1-yl)pyrimidin-5-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 59353376 |
| Molecular Formula | C29H22ClFN6O2 |
| Molecular Weight | 540.99 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | ethyl (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-(4-pyridin-4-ylpyrazol-1-yl)pyrimidin-5-yl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc(-c2cnc(Nc3ccc(F)c(Cl)c3)nc2-n2cc(-c3ccncc3)cn2)c1 |
| InChI | InChI=1S/C29H22ClFN6O2/c1-2-39-27(38)9-6-19-4-3-5-21(14-19)24-17-33-29(35-23-7-8-26(31)25(30)15-23)36-28(24)37-18-22(16-34-37)20-10-12-32-13-11-20/h3-18H,2H2,1H3,(H,33,35,36)/b9-6+ |
| InChIKey | ILPYTVJYQZARFT-RMKNXTFCSA-N |
| XLogP | 6.50 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.99 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|