C20H20ClFN6O — CID 59354561
[1-[2-(3-chloro-4-fluoroanilino)-5-pyrimidin-5-ylpyrimidin-4-yl]piperidin-3-yl]methanol (PubChem CID 59354561) has the molecular formula C20H20ClFN6O and a molecular weight of 414.87 g/mol. Its IUPAC name is [1-[2-(3-chloro-4-fluoroanilino)-5-pyrimidin-5-ylpyrimidin-4-yl]piperidin-3-yl]methanol.
| Compound Name | [1-[2-(3-chloro-4-fluoroanilino)-5-pyrimidin-5-ylpyrimidin-4-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 59354561 |
| Molecular Formula | C20H20ClFN6O |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [1-[2-(3-chloro-4-fluoroanilino)-5-pyrimidin-5-ylpyrimidin-4-yl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(c2nc(Nc3ccc(F)c(Cl)c3)ncc2-c2cncnc2)C1 |
| InChI | InChI=1S/C20H20ClFN6O/c21-17-6-15(3-4-18(17)22)26-20-25-9-16(14-7-23-12-24-8-14)19(27-20)28-5-1-2-13(10-28)11-29/h3-4,6-9,12-13,29H,1-2,5,10-11H2,(H,25,26,27) |
| InChIKey | IYWOCEPASAYBKA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |