C18H16ClFN6O — CID 59354474
1-[2-(3-chloro-4-fluoroanilino)-5-pyrimidin-5-ylpyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 59354474) has the molecular formula C18H16ClFN6O and a molecular weight of 386.82 g/mol. Its IUPAC name is 1-[2-(3-chloro-4-fluoroanilino)-5-pyrimidin-5-ylpyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | 1-[2-(3-chloro-4-fluoroanilino)-5-pyrimidin-5-ylpyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 59354474 |
| Molecular Formula | C18H16ClFN6O |
| Molecular Weight | 386.82 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-[2-(3-chloro-4-fluoroanilino)-5-pyrimidin-5-ylpyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | OC1CCN(c2nc(Nc3ccc(F)c(Cl)c3)ncc2-c2cncnc2)C1 |
| InChI | InChI=1S/C18H16ClFN6O/c19-15-5-12(1-2-16(15)20)24-18-23-8-14(11-6-21-10-22-7-11)17(25-18)26-4-3-13(27)9-26/h1-2,5-8,10,13,27H,3-4,9H2,(H,23,24,25) |
| InChIKey | DLQDUYZJWPRVPS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |