C56H37F6IrN2O- — CID 59356184
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-5-(2,3,4,5,6-pentakis-phenylphenyl)pyridine;iridium;1-pyridin-2-ylethenol (PubChem CID 59356184) has the molecular formula C56H37F6IrN2O- and a molecular weight of 1060.13 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-5-(2,3,4,5,6-pentakis-phenylphenyl)pyridine;iridium;1-pyridin-2-ylethenol.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-5-(2,3,4,5,6-pentakis-phenylphenyl)pyridine;iridium;1-pyridin-2-ylethenol |
|---|---|
| PubChem CID | 59356184 |
| Molecular Formula | C56H37F6IrN2O- |
| Molecular Weight | 1060.13 g/mol |
| Exact Mass | 1060.24 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-5-(2,3,4,5,6-pentakis-phenylphenyl)pyridine;iridium;1-pyridin-2-ylethenol |
| SMILES | C=C(O)c1ccccn1.FC(F)(F)c1[c-]c(-c2ccc(-c3c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c3-c3ccccc3)cn2)cc(C(F)(F)F)c1.[Ir] |
| InChI | InChI=1S/C49H30F6N.C7H7NO.Ir/c50-48(51,52)39-28-38(29-40(30-39)49(53,54)55)41-27-26-37(31-56-41)47-45(35-22-12-4-13-23-35)43(33-18-8-2-9-19-33)42(32-16-6-1-7-17-32)44(34-20-10-3-11-21-34)46(47)36-24-14-5-15-25-36;1-6(9)7-4-2-3-5-8-7;/h1-28,30-31H;2-5,9H,1H2;/q-1;; |
| InChIKey | ZPOIJACUDGYGJQ-UHFFFAOYSA-N |
| XLogP | 16.20 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1060.13 |
| LogP ≤ 5 | 16.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|