C11H23O5P — CID 59356188
2-(2-butoxyethoxy)-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 59356188) has the molecular formula C11H23O5P and a molecular weight of 266.27 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 2-(2-butoxyethoxy)-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 59356188 |
| Molecular Formula | C11H23O5P |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(2-butoxyethoxy)-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CCCCOCCOP1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C11H23O5P/c1-4-5-6-13-7-8-14-17(12)15-9-11(2,3)10-16-17/h4-10H2,1-3H3 |
| InChIKey | FJZGEZCVHWOQSX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|