C24H35N7O2 — CID 59356616
1-(4-methoxybutyl)-N-(2-methylpropyl)-N-[(3S,5R)-5-(1H-1,2,4-triazol-5-yl)piperidin-3-yl]benzimidazole-2-carboxamide (PubChem CID 59356616) has the molecular formula C24H35N7O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 1-(4-methoxybutyl)-N-(2-methylpropyl)-N-[(3S,5R)-5-(1H-1,2,4-triazol-5-yl)piperidin-3-yl]benzimidazole-2-carboxamide.
| Compound Name | 1-(4-methoxybutyl)-N-(2-methylpropyl)-N-[(3S,5R)-5-(1H-1,2,4-triazol-5-yl)piperidin-3-yl]benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 59356616 |
| Molecular Formula | C24H35N7O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 1-(4-methoxybutyl)-N-(2-methylpropyl)-N-[(3S,5R)-5-(1H-1,2,4-triazol-5-yl)piperidin-3-yl]benzimidazole-2-carboxamide |
| SMILES | COCCCCn1c(C(=O)N(CC(C)C)[C@@H]2CNC[C@H](c3ncn[nH]3)C2)nc2ccccc21 |
| InChI | InChI=1S/C24H35N7O2/c1-17(2)15-31(19-12-18(13-25-14-19)22-26-16-27-29-22)24(32)23-28-20-8-4-5-9-21(20)30(23)10-6-7-11-33-3/h4-5,8-9,16-19,25H,6-7,10-15H2,1-3H3,(H,26,27,29)/t18-,19+/m1/s1 |
| InChIKey | OQWHGMVSEWZBTC-MOPGFXCFSA-N |
| XLogP | 2.82 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|