C24H37N5O4 — CID 67320423
N-[(5S)-5-carbamoylpiperidin-3-yl]-4-methoxy-1-(4-methoxybutyl)-N-(2-methylpropyl)benzimidazole-2-carboxamide (PubChem CID 67320423) has the molecular formula C24H37N5O4 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[(5S)-5-carbamoylpiperidin-3-yl]-4-methoxy-1-(4-methoxybutyl)-N-(2-methylpropyl)benzimidazole-2-carboxamide.
| Compound Name | N-[(5S)-5-carbamoylpiperidin-3-yl]-4-methoxy-1-(4-methoxybutyl)-N-(2-methylpropyl)benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 67320423 |
| Molecular Formula | C24H37N5O4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | N-[(5S)-5-carbamoylpiperidin-3-yl]-4-methoxy-1-(4-methoxybutyl)-N-(2-methylpropyl)benzimidazole-2-carboxamide |
| SMILES | COCCCCn1c(C(=O)N(CC(C)C)C2CNC[C@@H](C(N)=O)C2)nc2c(OC)cccc21 |
| InChI | InChI=1S/C24H37N5O4/c1-16(2)15-29(18-12-17(22(25)30)13-26-14-18)24(31)23-27-21-19(8-7-9-20(21)33-4)28(23)10-5-6-11-32-3/h7-9,16-18,26H,5-6,10-15H2,1-4H3,(H2,25,30)/t17-,18?/m0/s1 |
| InChIKey | FEJQVHCPUAGCQR-ZENAZSQFSA-N |
| XLogP | 2.03 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|