C68H80N2Si6 — CID 59357230
[4-[2,6-bis[3,6-bis(trimethylsilyl)carbazol-9-yl]-10-(4-trimethylsilylphenyl)anthracen-9-yl]phenyl]-trimethylsilane (PubChem CID 59357230) has the molecular formula C68H80N2Si6 and a molecular weight of 1093.92 g/mol. Its IUPAC name is [4-[2,6-bis[3,6-bis(trimethylsilyl)carbazol-9-yl]-10-(4-trimethylsilylphenyl)anthracen-9-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[2,6-bis[3,6-bis(trimethylsilyl)carbazol-9-yl]-10-(4-trimethylsilylphenyl)anthracen-9-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 59357230 |
| Molecular Formula | C68H80N2Si6 |
| Molecular Weight | 1093.92 g/mol |
| Exact Mass | 1092.49 |
| IUPAC Name | [4-[2,6-bis[3,6-bis(trimethylsilyl)carbazol-9-yl]-10-(4-trimethylsilylphenyl)anthracen-9-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2c3ccc(-n4c5ccc([Si](C)(C)C)cc5c5cc([Si](C)(C)C)ccc54)cc3c(-c3ccc([Si](C)(C)C)cc3)c3ccc(-n4c5ccc([Si](C)(C)C)cc5c5cc([Si](C)(C)C)ccc54)cc23)cc1 |
| InChI | InChI=1S/C68H80N2Si6/c1-71(2,3)49-25-19-45(20-26-49)67-55-33-23-48(70-65-37-31-53(75(13,14)15)43-59(65)60-44-54(76(16,17)18)32-38-66(60)70)40-62(55)68(46-21-27-50(28-22-46)72(4,5)6)56-34-24-47(39-61(56)67)69-63-35-29-51(73(7,8)9)41-57(63)58-42-52(74(10,11)12)30-36-64(58)69/h19-44H,1-18H3 |
| InChIKey | OSBURTNBJCRMHT-UHFFFAOYSA-N |
| XLogP | 16.79 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1093.92 |
| LogP ≤ 5 | 16.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|