C74H72N2Si4 — CID 59357105
[9-[6-[3,6-bis(trimethylsilyl)carbazol-9-yl]-9,10-bis(4-phenylphenyl)anthracen-2-yl]-6-trimethylsilylcarbazol-3-yl]-trimethylsilane (PubChem CID 59357105) has the molecular formula C74H72N2Si4 and a molecular weight of 1101.75 g/mol. Its IUPAC name is [9-[6-[3,6-bis(trimethylsilyl)carbazol-9-yl]-9,10-bis(4-phenylphenyl)anthracen-2-yl]-6-trimethylsilylcarbazol-3-yl]-trimethylsilane.
| Compound Name | [9-[6-[3,6-bis(trimethylsilyl)carbazol-9-yl]-9,10-bis(4-phenylphenyl)anthracen-2-yl]-6-trimethylsilylcarbazol-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 59357105 |
| Molecular Formula | C74H72N2Si4 |
| Molecular Weight | 1101.75 g/mol |
| Exact Mass | 1100.48 |
| IUPAC Name | [9-[6-[3,6-bis(trimethylsilyl)carbazol-9-yl]-9,10-bis(4-phenylphenyl)anthracen-2-yl]-6-trimethylsilylcarbazol-3-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc2c(c1)c1cc([Si](C)(C)C)ccc1n2-c1ccc2c(-c3ccc(-c4ccccc4)cc3)c3cc(-n4c5ccc([Si](C)(C)C)cc5c5cc([Si](C)(C)C)ccc54)ccc3c(-c3ccc(-c4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C74H72N2Si4/c1-77(2,3)57-33-39-69-63(45-57)64-46-58(78(4,5)6)34-40-70(64)75(69)55-31-37-61-67(43-55)73(53-27-23-51(24-28-53)49-19-15-13-16-20-49)62-38-32-56(44-68(62)74(61)54-29-25-52(26-30-54)50-21-17-14-18-22-50)76-71-41-35-59(79(7,8)9)47-65(71)66-48-60(80(10,11)12)36-42-72(66)76/h13-48H,1-12H3 |
| InChIKey | GCIILJLRKBNDSX-UHFFFAOYSA-N |
| XLogP | 19.04 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1101.75 |
| LogP ≤ 5 | 19.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|