C78H78F2N2Si4 — CID 59357685
1-N,6-N-bis[2-fluoro-4,6-bis(4-trimethylsilylphenyl)phenyl]-1-N,6-N-bis(3-methylphenyl)pyrene-1,6-diamine (PubChem CID 59357685) has the molecular formula C78H78F2N2Si4 and a molecular weight of 1193.84 g/mol. Its IUPAC name is 1-N,6-N-bis[2-fluoro-4,6-bis(4-trimethylsilylphenyl)phenyl]-1-N,6-N-bis(3-methylphenyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis[2-fluoro-4,6-bis(4-trimethylsilylphenyl)phenyl]-1-N,6-N-bis(3-methylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 59357685 |
| Molecular Formula | C78H78F2N2Si4 |
| Molecular Weight | 1193.84 g/mol |
| Exact Mass | 1192.52 |
| IUPAC Name | 1-N,6-N-bis[2-fluoro-4,6-bis(4-trimethylsilylphenyl)phenyl]-1-N,6-N-bis(3-methylphenyl)pyrene-1,6-diamine |
| SMILES | Cc1cccc(N(c2c(F)cc(-c3ccc([Si](C)(C)C)cc3)cc2-c2ccc([Si](C)(C)C)cc2)c2ccc3ccc4c(N(c5cccc(C)c5)c5c(F)cc(-c6ccc([Si](C)(C)C)cc6)cc5-c5ccc([Si](C)(C)C)cc5)ccc5ccc2c3c54)c1 |
| InChI | InChI=1S/C78H78F2N2Si4/c1-51-17-15-19-61(45-51)81(77-69(55-25-37-65(38-26-55)85(9,10)11)47-59(49-71(77)79)53-21-33-63(34-22-53)83(3,4)5)73-43-31-57-30-42-68-74(44-32-58-29-41-67(73)75(57)76(58)68)82(62-20-16-18-52(2)46-62)78-70(56-27-39-66(40-28-56)86(12,13)14)48-60(50-72(78)80)54-23-35-64(36-24-54)84(6,7)8/h15-50H,1-14H3 |
| InChIKey | DFADJPGTTMYGKX-UHFFFAOYSA-N |
| XLogP | 21.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1193.84 |
| LogP ≤ 5 | 21.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|