C84H90F2N2Si4 — CID 59357783
1-N,6-N-bis(2-tert-butylphenyl)-1-N,6-N-bis[2-fluoro-4,6-bis(4-trimethylsilylphenyl)phenyl]pyrene-1,6-diamine (PubChem CID 59357783) has the molecular formula C84H90F2N2Si4 and a molecular weight of 1278.00 g/mol. Its IUPAC name is 1-N,6-N-bis(2-tert-butylphenyl)-1-N,6-N-bis[2-fluoro-4,6-bis(4-trimethylsilylphenyl)phenyl]pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(2-tert-butylphenyl)-1-N,6-N-bis[2-fluoro-4,6-bis(4-trimethylsilylphenyl)phenyl]pyrene-1,6-diamine |
|---|---|
| PubChem CID | 59357783 |
| Molecular Formula | C84H90F2N2Si4 |
| Molecular Weight | 1278.00 g/mol |
| Exact Mass | 1276.61 |
| IUPAC Name | 1-N,6-N-bis(2-tert-butylphenyl)-1-N,6-N-bis[2-fluoro-4,6-bis(4-trimethylsilylphenyl)phenyl]pyrene-1,6-diamine |
| SMILES | CC(C)(C)c1ccccc1N(c1c(F)cc(-c2ccc([Si](C)(C)C)cc2)cc1-c1ccc([Si](C)(C)C)cc1)c1ccc2ccc3c(N(c4ccccc4C(C)(C)C)c4c(F)cc(-c5ccc([Si](C)(C)C)cc5)cc4-c4ccc([Si](C)(C)C)cc4)ccc4ccc1c2c43 |
| InChI | InChI=1S/C84H90F2N2Si4/c1-83(2,3)71-23-19-21-25-77(71)87(81-69(57-31-43-65(44-32-57)91(13,14)15)51-61(53-73(81)85)55-27-39-63(40-28-55)89(7,8)9)75-49-37-59-36-48-68-76(50-38-60-35-47-67(75)79(59)80(60)68)88(78-26-22-20-24-72(78)84(4,5)6)82-70(58-33-45-66(46-34-58)92(16,17)18)52-62(54-74(82)86)56-29-41-64(42-30-56)90(10,11)12/h19-54H,1-18H3 |
| InChIKey | BPICBAJEBLWMPS-UHFFFAOYSA-N |
| XLogP | 23.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1278.00 |
| LogP ≤ 5 | 23.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|