C34H19F3IrN3- — CID 59358824
iridium;2-[4-[9-(trifluoromethyl)carbazol-3-yl]phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide (PubChem CID 59358824) has the molecular formula C34H19F3IrN3- and a molecular weight of 718.76 g/mol. Its IUPAC name is iridium;2-[4-[9-(trifluoromethyl)carbazol-3-yl]phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide.
| Compound Name | iridium;2-[4-[9-(trifluoromethyl)carbazol-3-yl]phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide |
|---|---|
| PubChem CID | 59358824 |
| Molecular Formula | C34H19F3IrN3- |
| Molecular Weight | 718.76 g/mol |
| Exact Mass | 719.12 |
| IUPAC Name | iridium;2-[4-[9-(trifluoromethyl)carbazol-3-yl]phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide |
| SMILES | FC(F)(F)n1c2ccccc2c2cc(-c3ccc(-c4cn5c6ccccc6c6ccc[c-]c6c5n4)cc3)ccc21.[Ir] |
| InChI | InChI=1S/C34H19F3N3.Ir/c35-34(36,37)40-31-12-6-4-9-26(31)28-19-23(17-18-32(28)40)21-13-15-22(16-14-21)29-20-39-30-11-5-3-8-25(30)24-7-1-2-10-27(24)33(39)38-29;/h1-9,11-20H;/q-1; |
| InChIKey | VJFORCQWFJBOGH-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.76 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|