C18H16N2 — CID 59358884
2,5,7-trimethylimidazo[1,2-f]phenanthridine (PubChem CID 59358884) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2,5,7-trimethylimidazo[1,2-f]phenanthridine.
| Compound Name | 2,5,7-trimethylimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 59358884 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2,5,7-trimethylimidazo[1,2-f]phenanthridine |
| SMILES | Cc1cc(C)c2c(c1)c1ccccc1c1nc(C)cn12 |
| InChI | InChI=1S/C18H16N2/c1-11-8-12(2)17-16(9-11)14-6-4-5-7-15(14)18-19-13(3)10-20(17)18/h4-10H,1-3H3 |
| InChIKey | STCJUHALHNAFAF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|