C35H21IrN4S- — CID 59359019
CID 59359019 (PubChem CID 59359019) has the molecular formula C35H21IrN4S- and a molecular weight of 721.87 g/mol.
| Compound Name | CID 59359019 |
|---|---|
| PubChem CID | 59359019 |
| Molecular Formula | C35H21IrN4S- |
| Molecular Weight | 721.87 g/mol |
| Exact Mass | 722.11 |
| IUPAC Name | — |
| SMILES | Cc1nc2c3c([c-]cc4ccccc43)c3ncc(-c4cccc(-n5c6ccccc6c6ccccc65)c4)n3c2s1.[Ir] |
| InChI | InChI=1S/C35H21N4S.Ir/c1-21-37-33-32-25-12-3-2-9-22(25)17-18-28(32)34-36-20-31(39(34)35(33)40-21)23-10-8-11-24(19-23)38-29-15-6-4-13-26(29)27-14-5-7-16-30(27)38;/h2-17,19-20H,1H3;/q-1; |
| InChIKey | IZSTXYUHUMLYJF-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.87 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|