C31H18IrN3S- — CID 59359414
10-(5-carbazol-9-ylthiophen-2-yl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium (PubChem CID 59359414) has the molecular formula C31H18IrN3S- and a molecular weight of 656.79 g/mol. Its IUPAC name is 10-(5-carbazol-9-ylthiophen-2-yl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium.
| Compound Name | 10-(5-carbazol-9-ylthiophen-2-yl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
|---|---|
| PubChem CID | 59359414 |
| Molecular Formula | C31H18IrN3S- |
| Molecular Weight | 656.79 g/mol |
| Exact Mass | 657.09 |
| IUPAC Name | 10-(5-carbazol-9-ylthiophen-2-yl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
| SMILES | [Ir].[c-]1cc(-c2ccc(-n3c4ccccc4c4ccccc43)s2)cc2c1c1nccn1c1ccccc21 |
| InChI | InChI=1S/C31H18N3S.Ir/c1-4-10-26-23(9-1)25-19-20(13-14-24(25)31-32-17-18-33(26)31)29-15-16-30(35-29)34-27-11-5-2-7-21(27)22-8-3-6-12-28(22)34;/h1-13,15-19H;/q-1; |
| InChIKey | OKGONCPXAFDLQN-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.79 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|