About 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide
4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 59361004) has the molecular formula C7H5ClN4O
and a molecular weight of 196.60 g/mol. Its IUPAC name is 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| PubChem CID | 59361004 |
| Molecular Formula | C7H5ClN4O |
| Molecular Weight | 196.60 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1c[nH]c2ncnc(Cl)c12 |
| InChI | InChI=1S/C7H5ClN4O/c8-5-4-3(6(9)13)1-10-7(4)12-2-11-5/h1-2H,(H2,9,13)(H,10,11,12) |
| InChIKey | UDUGGOYXXDQLEP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.60 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide?
The IUPAC name of 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide (CID 59361004) is 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide.
What is the SMILES notation for 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide?
The canonical SMILES for 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide is NC(=O)c1c[nH]c2ncnc(Cl)c12.
What is the InChIKey of 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide?
The InChIKey is UDUGGOYXXDQLEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN4O/c8-5-4-3(6(9)13)1-10-7(4)12-2-11-5/h1-2H,(H2,9,13)(H,10,11,12).
What are the key properties of 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide?
4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide has a molecular weight of 196.60 g/mol, XLogP of 0.71, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide is sourced from PubChem (CID 59361004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).