C17H26ClNO3 — CID 59364370
tert-butyl N-[3-(3-chlorophenyl)-3-hydroxypropyl]-N-propan-2-ylcarbamate (PubChem CID 59364370) has the molecular formula C17H26ClNO3 and a molecular weight of 327.85 g/mol. Its IUPAC name is tert-butyl N-[3-(3-chlorophenyl)-3-hydroxypropyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[3-(3-chlorophenyl)-3-hydroxypropyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 59364370 |
| Molecular Formula | C17H26ClNO3 |
| Molecular Weight | 327.85 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | tert-butyl N-[3-(3-chlorophenyl)-3-hydroxypropyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CCC(O)c1cccc(Cl)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26ClNO3/c1-12(2)19(16(21)22-17(3,4)5)10-9-15(20)13-7-6-8-14(18)11-13/h6-8,11-12,15,20H,9-10H2,1-5H3 |
| InChIKey | GJYIARCBFVVTDD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |